About N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide
N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide (PubChem CID 163913276) has the molecular formula C27H30FNO2
and a molecular weight of 419.54 g/mol. Its IUPAC name is N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide |
| PubChem CID | 163913276 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide |
| SMILES | Cc1ccc(C(Oc2cc(C(=O)NC(C)(C)C)ccc2F)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C27H30FNO2/c1-17-7-10-20(11-8-17)25(22-13-9-18(2)15-19(22)3)31-24-16-21(12-14-23(24)28)26(30)29-27(4,5)6/h7-16,25H,1-6H3,(H,29,30) |
| InChIKey | QUAVSCZUXQDGCX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide?
The IUPAC name of N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide (CID 163913276) is N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide.
What is the SMILES notation for N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide?
The canonical SMILES for N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide is Cc1ccc(C(Oc2cc(C(=O)NC(C)(C)C)ccc2F)c2ccc(C)cc2C)cc1.
What is the InChIKey of N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide?
The InChIKey is QUAVSCZUXQDGCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30FNO2/c1-17-7-10-20(11-8-17)25(22-13-9-18(2)15-19(22)3)31-24-16-21(12-14-23(24)28)26(30)29-27(4,5)6/h7-16,25H,1-6H3,(H,29,30).
What are the key properties of N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide?
N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide has a molecular weight of 419.54 g/mol, XLogP of 6.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-[(2,4-dimethylphenyl)-(4-methylphenyl)methoxy]-4-fluorobenzamide is sourced from PubChem (CID 163913276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).