C11H15BFNO3 — CID 44717479
[5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid (PubChem CID 44717479) has the molecular formula C11H15BFNO3 and a molecular weight of 239.06 g/mol. Its IUPAC name is [5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid.
| Compound Name | [5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 44717479 |
| Molecular Formula | C11H15BFNO3 |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid |
| SMILES | CC(C)(C)NC(=O)c1ccc(F)c(B(O)O)c1 |
| InChI | InChI=1S/C11H15BFNO3/c1-11(2,3)14-10(15)7-4-5-9(13)8(6-7)12(16)17/h4-6,16-17H,1-3H3,(H,14,15) |
| InChIKey | KKSGPXWRHLBCCW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|