C14H17N3O3 — CID 163913878
5-(methylamino)-2-(1-oxido-2-oxopiperidin-1-ium-3-yl)-3H-isoindol-1-one (PubChem CID 163913878) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-(methylamino)-2-(1-oxido-2-oxopiperidin-1-ium-3-yl)-3H-isoindol-1-one.
| Compound Name | 5-(methylamino)-2-(1-oxido-2-oxopiperidin-1-ium-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 163913878 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-(methylamino)-2-(1-oxido-2-oxopiperidin-1-ium-3-yl)-3H-isoindol-1-one |
| SMILES | CNc1ccc2c(c1)CN(C1CCC[NH+]([O-])C1=O)C2=O |
| InChI | InChI=1S/C14H17N3O3/c1-15-10-4-5-11-9(7-10)8-16(13(11)18)12-3-2-6-17(20)14(12)19/h4-5,7,12,15,17H,2-3,6,8H2,1H3 |
| InChIKey | QUNQELKFFOBEGI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 76.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |