C8H11NO2 — CID 163915753
(6S)-3-methylspiro[7-oxa-3-azabicyclo[4.1.0]heptane-5,1'-cyclopropane]-4-one (PubChem CID 163915753) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (6S)-3-methylspiro[7-oxa-3-azabicyclo[4.1.0]heptane-5,1'-cyclopropane]-4-one.
| Compound Name | (6S)-3-methylspiro[7-oxa-3-azabicyclo[4.1.0]heptane-5,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 163915753 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (6S)-3-methylspiro[7-oxa-3-azabicyclo[4.1.0]heptane-5,1'-cyclopropane]-4-one |
| SMILES | CN1CC2O[C@H]2C2(CC2)C1=O |
| InChI | InChI=1S/C8H11NO2/c1-9-4-5-6(11-5)8(2-3-8)7(9)10/h5-6H,2-4H2,1H3/t5?,6-/m1/s1 |
| InChIKey | QWCDKXAKTFKBPC-PRJDIBJQSA-N |
| XLogP | 0.01 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|