C10H17NO2 — CID 156547568
2,3,4-trimethyl-7-oxa-2-azaspiro[4.4]nonan-1-one (PubChem CID 156547568) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,3,4-trimethyl-7-oxa-2-azaspiro[4.4]nonan-1-one.
| Compound Name | 2,3,4-trimethyl-7-oxa-2-azaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 156547568 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2,3,4-trimethyl-7-oxa-2-azaspiro[4.4]nonan-1-one |
| SMILES | CC1C(C)C2(CCOC2)C(=O)N1C |
| InChI | InChI=1S/C10H17NO2/c1-7-8(2)11(3)9(12)10(7)4-5-13-6-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | UDSGSAQJOPHZAU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |