C27H27F3N4O6 — CID 163918081
3-[4-[[[4-hydroxy-5-methyl-2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]carbamoylamino]methyl]phenoxy]-N-methylbenzamide (PubChem CID 163918081) has the molecular formula C27H27F3N4O6 and a molecular weight of 560.53 g/mol. Its IUPAC name is 3-[4-[[[4-hydroxy-5-methyl-2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]carbamoylamino]methyl]phenoxy]-N-methylbenzamide.
| Compound Name | 3-[4-[[[4-hydroxy-5-methyl-2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]carbamoylamino]methyl]phenoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 163918081 |
| Molecular Formula | C27H27F3N4O6 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 3-[4-[[[4-hydroxy-5-methyl-2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]carbamoylamino]methyl]phenoxy]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(Oc2ccc(CNC(=O)Nc3cc(C)c(O)cc3OCCNC(=O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H27F3N4O6/c1-16-12-21(23(14-22(16)35)39-11-10-32-25(37)27(28,29)30)34-26(38)33-15-17-6-8-19(9-7-17)40-20-5-3-4-18(13-20)24(36)31-2/h3-9,12-14,35H,10-11,15H2,1-2H3,(H,31,36)(H,32,37)(H2,33,34,38) |
| InChIKey | QYAIRPRNGNGGBK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|