C12H17N — CID 163918404
5-methylidene-1-propan-2-yl-1,4,6,7-tetrahydroisoindole (PubChem CID 163918404) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 5-methylidene-1-propan-2-yl-1,4,6,7-tetrahydroisoindole.
| Compound Name | 5-methylidene-1-propan-2-yl-1,4,6,7-tetrahydroisoindole |
|---|---|
| PubChem CID | 163918404 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-methylidene-1-propan-2-yl-1,4,6,7-tetrahydroisoindole |
| SMILES | C=C1CCC2=C(C=NC2C(C)C)C1 |
| InChI | InChI=1S/C12H17N/c1-8(2)12-11-5-4-9(3)6-10(11)7-13-12/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | QYHKWCHBYYLYDT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|