C12H19N — CID 58394762
5-tert-butyl-4,5,6,7-tetrahydro-1H-isoindole (PubChem CID 58394762) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 5-tert-butyl-4,5,6,7-tetrahydro-1H-isoindole.
| Compound Name | 5-tert-butyl-4,5,6,7-tetrahydro-1H-isoindole |
|---|---|
| PubChem CID | 58394762 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5-tert-butyl-4,5,6,7-tetrahydro-1H-isoindole |
| SMILES | CC(C)(C)C1CCC2=C(C=NC2)C1 |
| InChI | InChI=1S/C12H19N/c1-12(2,3)11-5-4-9-7-13-8-10(9)6-11/h8,11H,4-7H2,1-3H3 |
| InChIKey | DWPOPMCSEOMHFP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |