About 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole
4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole (PubChem CID 164981744) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole.
Analyze 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole?
The IUPAC name of 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole (CID 164981744) is 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole.
What is the SMILES notation for 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole?
The canonical SMILES for 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole is CC1(C)CC(C)(C)C2=C1C=NC2.
What is the InChIKey of 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole?
The InChIKey is JDIINZZWCJZLGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-10(2)7-11(3,4)9-6-12-5-8(9)10/h5H,6-7H2,1-4H3.
What are the key properties of 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole?
4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole has a molecular weight of 163.26 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,6,6-tetramethyl-1,5-dihydrocyclopenta[c]pyrrole is sourced from PubChem (CID 164981744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).