C13H21N — CID 158199397
5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indole (PubChem CID 158199397) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indole.
| Compound Name | 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indole |
|---|---|
| PubChem CID | 158199397 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indole |
| SMILES | CC1=C2CC(C(C)(C)C)CCC2=NC1 |
| InChI | InChI=1S/C13H21N/c1-9-8-14-12-6-5-10(7-11(9)12)13(2,3)4/h10H,5-8H2,1-4H3 |
| InChIKey | YZJWQCKXWHTKTQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |