C14H27N — CID 142124043
ethane;7-methyl-4,5,6,7-tetrahydro-2H-indole;propane (PubChem CID 142124043) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;7-methyl-4,5,6,7-tetrahydro-2H-indole;propane.
| Compound Name | ethane;7-methyl-4,5,6,7-tetrahydro-2H-indole;propane |
|---|---|
| PubChem CID | 142124043 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;7-methyl-4,5,6,7-tetrahydro-2H-indole;propane |
| SMILES | CC.CC1CCCC2=CCN=C21.CCC |
| InChI | InChI=1S/C9H13N.C3H8.C2H6/c1-7-3-2-4-8-5-6-10-9(7)8;1-3-2;1-2/h5,7H,2-4,6H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | PMDNKCCREDSPRF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |