C19H17F2N8OP — CID 163920046
3-[difluoro(indolizin-6-yl)methyl]-5-[1-(dimethylphosphorylmethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine (PubChem CID 163920046) has the molecular formula C19H17F2N8OP and a molecular weight of 442.37 g/mol. Its IUPAC name is 3-[difluoro(indolizin-6-yl)methyl]-5-[1-(dimethylphosphorylmethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine.
| Compound Name | 3-[difluoro(indolizin-6-yl)methyl]-5-[1-(dimethylphosphorylmethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 163920046 |
| Molecular Formula | C19H17F2N8OP |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-[difluoro(indolizin-6-yl)methyl]-5-[1-(dimethylphosphorylmethyl)pyrazol-4-yl]triazolo[4,5-b]pyrazine |
| SMILES | CP(C)(=O)Cn1cc(-c2cnc3nnn(C(F)(F)c4ccc5cccn5c4)c3n2)cn1 |
| InChI | InChI=1S/C19H17F2N8OP/c1-31(2,30)12-28-10-13(8-23-28)16-9-22-17-18(24-16)29(26-25-17)19(20,21)14-5-6-15-4-3-7-27(15)11-14/h3-11H,12H2,1-2H3 |
| InChIKey | JTZUQILSLKLKNM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|