C20H20N7OP — CID 163933665
5-[1-(dimethylphosphorylmethyl)pyrrol-3-yl]-3-(indolizin-6-ylmethyl)triazolo[4,5-b]pyrazine (PubChem CID 163933665) has the molecular formula C20H20N7OP and a molecular weight of 405.40 g/mol. Its IUPAC name is 5-[1-(dimethylphosphorylmethyl)pyrrol-3-yl]-3-(indolizin-6-ylmethyl)triazolo[4,5-b]pyrazine.
| Compound Name | 5-[1-(dimethylphosphorylmethyl)pyrrol-3-yl]-3-(indolizin-6-ylmethyl)triazolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 163933665 |
| Molecular Formula | C20H20N7OP |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 5-[1-(dimethylphosphorylmethyl)pyrrol-3-yl]-3-(indolizin-6-ylmethyl)triazolo[4,5-b]pyrazine |
| SMILES | CP(C)(=O)Cn1ccc(-c2cnc3nnn(Cc4ccc5cccn5c4)c3n2)c1 |
| InChI | InChI=1S/C20H20N7OP/c1-29(2,28)14-25-9-7-16(13-25)18-10-21-19-20(22-18)27(24-23-19)12-15-5-6-17-4-3-8-26(17)11-15/h3-11,13H,12,14H2,1-2H3 |
| InChIKey | OCJQFAWGYWHNTE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|