C23H23N6O2P — CID 163920050
5-[4-[ethyl(methoxy)phosphoryl]phenyl]-3-(1-indolizin-6-ylethyl)triazolo[4,5-b]pyrazine (PubChem CID 163920050) has the molecular formula C23H23N6O2P and a molecular weight of 446.45 g/mol. Its IUPAC name is 5-[4-[ethyl(methoxy)phosphoryl]phenyl]-3-(1-indolizin-6-ylethyl)triazolo[4,5-b]pyrazine.
| Compound Name | 5-[4-[ethyl(methoxy)phosphoryl]phenyl]-3-(1-indolizin-6-ylethyl)triazolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 163920050 |
| Molecular Formula | C23H23N6O2P |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-[4-[ethyl(methoxy)phosphoryl]phenyl]-3-(1-indolizin-6-ylethyl)triazolo[4,5-b]pyrazine |
| SMILES | CCP(=O)(OC)c1ccc(-c2cnc3nnn(C(C)c4ccc5cccn5c4)c3n2)cc1 |
| InChI | InChI=1S/C23H23N6O2P/c1-4-32(30,31-3)20-11-8-17(9-12-20)21-14-24-22-23(25-21)29(27-26-22)16(2)18-7-10-19-6-5-13-28(19)15-18/h5-16H,4H2,1-3H3 |
| InChIKey | SKUWFVZKVDJGOB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|