C8H8N2O — CID 175653982
pyrrolo[1,2-a]pyrazin-3-ylmethanol (PubChem CID 175653982) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is pyrrolo[1,2-a]pyrazin-3-ylmethanol.
| Compound Name | pyrrolo[1,2-a]pyrazin-3-ylmethanol |
|---|---|
| PubChem CID | 175653982 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | pyrrolo[1,2-a]pyrazin-3-ylmethanol |
| SMILES | OCc1cn2cccc2cn1 |
| InChI | InChI=1S/C8H8N2O/c11-6-7-5-10-3-1-2-8(10)4-9-7/h1-5,11H,6H2 |
| InChIKey | MWBRANUITZUGNV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |