C7H7N3 — CID 141140898
pyrrolo[1,2-a]pyrazin-3-amine (PubChem CID 141140898) has the molecular formula C7H7N3 and a molecular weight of 133.15 g/mol. Its IUPAC name is pyrrolo[1,2-a]pyrazin-3-amine.
| Compound Name | pyrrolo[1,2-a]pyrazin-3-amine |
|---|---|
| PubChem CID | 141140898 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | pyrrolo[1,2-a]pyrazin-3-amine |
| SMILES | Nc1cn2cccc2cn1 |
| InChI | InChI=1S/C7H7N3/c8-7-5-10-3-1-2-6(10)4-9-7/h1-5H,8H2 |
| InChIKey | UAEDKTMPRIFGEN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |