C13H16N4O — CID 178134180
ethane;(1-imidazo[1,2-a]pyridin-8-ylimidazol-4-yl)methanol (PubChem CID 178134180) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is ethane;(1-imidazo[1,2-a]pyridin-8-ylimidazol-4-yl)methanol.
| Compound Name | ethane;(1-imidazo[1,2-a]pyridin-8-ylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 178134180 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | ethane;(1-imidazo[1,2-a]pyridin-8-ylimidazol-4-yl)methanol |
| SMILES | CC.OCc1cn(-c2cccn3ccnc23)cn1 |
| InChI | InChI=1S/C11H10N4O.C2H6/c16-7-9-6-15(8-13-9)10-2-1-4-14-5-3-12-11(10)14;1-2/h1-6,8,16H,7H2;1-2H3 |
| InChIKey | KYHOTMRZOOFHPU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |