C29H53N5O10 — CID 163921116
8-[3-[2-[2-[3-[[4-[[(5S)-5-carboxy-5-(2-methylidenehydrazinyl)pentyl]amino]-4-oxobutanoyl]amino]propoxy]ethoxy]ethoxy]propylamino]-8-oxooctanoic acid (PubChem CID 163921116) has the molecular formula C29H53N5O10 and a molecular weight of 631.77 g/mol. Its IUPAC name is 8-[3-[2-[2-[3-[[4-[[(5S)-5-carboxy-5-(2-methylidenehydrazinyl)pentyl]amino]-4-oxobutanoyl]amino]propoxy]ethoxy]ethoxy]propylamino]-8-oxooctanoic acid.
| Compound Name | 8-[3-[2-[2-[3-[[4-[[(5S)-5-carboxy-5-(2-methylidenehydrazinyl)pentyl]amino]-4-oxobutanoyl]amino]propoxy]ethoxy]ethoxy]propylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 163921116 |
| Molecular Formula | C29H53N5O10 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.38 |
| IUPAC Name | 8-[3-[2-[2-[3-[[4-[[(5S)-5-carboxy-5-(2-methylidenehydrazinyl)pentyl]amino]-4-oxobutanoyl]amino]propoxy]ethoxy]ethoxy]propylamino]-8-oxooctanoic acid |
| SMILES | C=NN[C@@H](CCCCNC(=O)CCC(=O)NCCCOCCOCCOCCCNC(=O)CCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H53N5O10/c1-30-34-24(29(40)41)10-6-7-15-31-26(36)13-14-27(37)33-17-9-19-43-21-23-44-22-20-42-18-8-16-32-25(35)11-4-2-3-5-12-28(38)39/h24,34H,1-23H2,(H,31,36)(H,32,35)(H,33,37)(H,38,39)(H,40,41)/t24-/m0/s1 |
| InChIKey | RAMHBZWUEQKIRK-DEOSSOPVSA-N |
| XLogP | 1.20 |
| TPSA | 213.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|