C27H34BFN3O3 — CID 163921860
CID 163921860 (PubChem CID 163921860) has the molecular formula C27H34BFN3O3 and a molecular weight of 478.40 g/mol.
| Compound Name | CID 163921860 |
|---|---|
| PubChem CID | 163921860 |
| Molecular Formula | C27H34BFN3O3 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\C)OCc1c([B]OC(C)(C)C(C)C)cccc1-n1ncc2cc(C(C)(C)C)cc(F)c2c1=O |
| InChI | InChI=1S/C27H34BFN3O3/c1-16(2)27(7,8)35-28-21-10-9-11-23(20(21)15-34-17(3)30)32-25(33)24-18(14-31-32)12-19(13-22(24)29)26(4,5)6/h9-14,16,30H,15H2,1-8H3/b30-17+ |
| InChIKey | LHSQSKTYOQTNRN-OCSSWDANSA-N |
| XLogP | 5.03 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|