C27H44N4O10 — CID 163922208
3,4-dihydroxybenzoic acid;N-methyl-3-[2-[2-[2-[2-[[1-(3-methylbutyl)triazol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 163922208) has the molecular formula C27H44N4O10 and a molecular weight of 584.67 g/mol. Its IUPAC name is 3,4-dihydroxybenzoic acid;N-methyl-3-[2-[2-[2-[2-[[1-(3-methylbutyl)triazol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | 3,4-dihydroxybenzoic acid;N-methyl-3-[2-[2-[2-[2-[[1-(3-methylbutyl)triazol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 163922208 |
| Molecular Formula | C27H44N4O10 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 3,4-dihydroxybenzoic acid;N-methyl-3-[2-[2-[2-[2-[[1-(3-methylbutyl)triazol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | CNC(=O)CCOCCOCCOCCOCCOCc1cn(CCC(C)C)nn1.O=C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H38N4O6.C7H6O4/c1-18(2)4-6-24-16-19(22-23-24)17-30-15-14-29-13-12-28-11-10-27-9-8-26-7-5-20(25)21-3;8-5-2-1-4(7(10)11)3-6(5)9/h16,18H,4-15,17H2,1-3H3,(H,21,25);1-3,8-9H,(H,10,11) |
| InChIKey | RBJKCZBZGOTHRT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 183.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|