C19H31NO4 — CID 163927081
ethenyl (3S,5S)-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]-3,5-dimethyl-3-propylpiperidine-1-carboxylate (PubChem CID 163927081) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is ethenyl (3S,5S)-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]-3,5-dimethyl-3-propylpiperidine-1-carboxylate.
| Compound Name | ethenyl (3S,5S)-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]-3,5-dimethyl-3-propylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 163927081 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | ethenyl (3S,5S)-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]-3,5-dimethyl-3-propylpiperidine-1-carboxylate |
| SMILES | C=COC(=O)N1C[C@@H](C)C(/C=C(\C)C(=O)OCC)[C@](C)(CCC)C1 |
| InChI | InChI=1S/C19H31NO4/c1-7-10-19(6)13-20(18(22)24-9-3)12-15(5)16(19)11-14(4)17(21)23-8-2/h9,11,15-16H,3,7-8,10,12-13H2,1-2,4-6H3/b14-11+/t15-,16?,19-/m1/s1 |
| InChIKey | RFKMMBDOCAYALP-ISRDJWQISA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|