C33H40F4N4O6S — CID 163928180
N-butyl-N-(3-hydroxypropyl)-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzamide (PubChem CID 163928180) has the molecular formula C33H40F4N4O6S and a molecular weight of 696.76 g/mol. Its IUPAC name is N-butyl-N-(3-hydroxypropyl)-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzamide.
| Compound Name | N-butyl-N-(3-hydroxypropyl)-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 163928180 |
| Molecular Formula | C33H40F4N4O6S |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | N-butyl-N-(3-hydroxypropyl)-3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]benzamide |
| SMILES | CCCCN(CCCO)C(=O)c1cc(C)c(/C=C/S(=O)(=O)N2CCC3(CC2)N=C(c2ccc(OC(F)(F)C(F)F)cc2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C33H40F4N4O6S/c1-4-5-14-40(15-6-18-42)29(43)25-20-22(2)27(23(3)21-25)11-19-48(45,46)41-16-12-32(13-17-41)31(44)38-28(39-32)24-7-9-26(10-8-24)47-33(36,37)30(34)35/h7-11,19-21,30,42H,4-6,12-18H2,1-3H3,(H,38,39,44)/b19-11+ |
| InChIKey | RGIIVXPUMDXAFH-YBFXNURJSA-N |
| XLogP | 4.88 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|