C13H22N2OS — CID 163931938
6-spiro[1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole-2,1'-cyclopropane]-4-ylhexan-2-one (PubChem CID 163931938) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 6-spiro[1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole-2,1'-cyclopropane]-4-ylhexan-2-one.
| Compound Name | 6-spiro[1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole-2,1'-cyclopropane]-4-ylhexan-2-one |
|---|---|
| PubChem CID | 163931938 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-spiro[1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole-2,1'-cyclopropane]-4-ylhexan-2-one |
| SMILES | CC(=O)CCCCC1SCC2NC3(CC3)NC21 |
| InChI | InChI=1S/C13H22N2OS/c1-9(16)4-2-3-5-11-12-10(8-17-11)14-13(15-12)6-7-13/h10-12,14-15H,2-8H2,1H3 |
| InChIKey | RJKGKIOWCVPLAS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|