C15H11F2N3 — CID 163932028
N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]methanimine (PubChem CID 163932028) has the molecular formula C15H11F2N3 and a molecular weight of 271.27 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]methanimine.
| Compound Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]methanimine |
|---|---|
| PubChem CID | 163932028 |
| Molecular Formula | C15H11F2N3 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]methanimine |
| SMILES | C=Nc1n[nH]c2ccc(Cc3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C15H11F2N3/c1-18-15-13-7-9(2-3-14(13)19-20-15)4-10-5-11(16)8-12(17)6-10/h2-3,5-8H,1,4H2,(H,19,20) |
| InChIKey | RJMHXJARFGTGJA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|