C25H27N7O — CID 163932356
2-[3-[(2R)-5-phenylpentan-2-yl]aziridin-2-yl]-N-[3-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]acetamide (PubChem CID 163932356) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-[3-[(2R)-5-phenylpentan-2-yl]aziridin-2-yl]-N-[3-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]acetamide.
| Compound Name | 2-[3-[(2R)-5-phenylpentan-2-yl]aziridin-2-yl]-N-[3-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]acetamide |
|---|---|
| PubChem CID | 163932356 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-[3-[(2R)-5-phenylpentan-2-yl]aziridin-2-yl]-N-[3-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]acetamide |
| SMILES | C[C@H](CCCc1ccccc1)C1NC1CC(=O)Nc1ccc2ncc(-c3cn[nH]c3)nc2n1 |
| InChI | InChI=1S/C25H27N7O/c1-16(6-5-9-17-7-3-2-4-8-17)24-20(29-24)12-23(33)31-22-11-10-19-25(32-22)30-21(15-26-19)18-13-27-28-14-18/h2-4,7-8,10-11,13-16,20,24,29H,5-6,9,12H2,1H3,(H,27,28)(H,30,31,32,33)/t16-,20?,24?/m1/s1 |
| InChIKey | RJTQRPAUSOAGMB-VIBJYCFESA-N |
| XLogP | 3.74 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|