C14H22N2 — CID 163933497
N-methyl-5-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]-1,2-dihydropyridin-6-amine (PubChem CID 163933497) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-methyl-5-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]-1,2-dihydropyridin-6-amine.
| Compound Name | N-methyl-5-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 163933497 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-methyl-5-[(2E,4Z)-3-methylhepta-2,4-dien-2-yl]-1,2-dihydropyridin-6-amine |
| SMILES | CC/C=C\C(C)=C(/C)C1=C(NC)NCC=C1 |
| InChI | InChI=1S/C14H22N2/c1-5-6-8-11(2)12(3)13-9-7-10-16-14(13)15-4/h6-9,15-16H,5,10H2,1-4H3/b8-6-,12-11+ |
| InChIKey | RKSPHEUQPHLYBE-JKJKEFMNSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|