C10H19FN2 — CID 163595306
N-ethyl-N'-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]methanediamine (PubChem CID 163595306) has the molecular formula C10H19FN2 and a molecular weight of 186.27 g/mol. Its IUPAC name is N-ethyl-N'-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]methanediamine.
| Compound Name | N-ethyl-N'-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]methanediamine |
|---|---|
| PubChem CID | 163595306 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | N-ethyl-N'-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]methanediamine |
| SMILES | C/C=C(CNCNCC)\C(F)=C/C |
| InChI | InChI=1S/C10H19FN2/c1-4-9(10(11)5-2)7-13-8-12-6-3/h4-5,12-13H,6-8H2,1-3H3/b9-4-,10-5+ |
| InChIKey | GSXVSCPYTLZUPM-DHPVUTNOSA-N |
| XLogP | 1.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|