About N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine
N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine (PubChem CID 163935804) has the molecular formula C9H13F3N4
and a molecular weight of 234.22 g/mol. Its IUPAC name is N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine.
Molecular Properties
| Compound Name | N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine |
| PubChem CID | 163935804 |
| Molecular Formula | C9H13F3N4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine |
| SMILES | CNCNCc1c(C)ncnc1C(F)(F)F |
| InChI | InChI=1S/C9H13F3N4/c1-6-7(3-14-4-13-2)8(9(10,11)12)16-5-15-6/h5,13-14H,3-4H2,1-2H3 |
| InChIKey | RMRZVZQYZPNECV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine?
The IUPAC name of N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine (CID 163935804) is N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine.
What is the SMILES notation for N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine?
The canonical SMILES for N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine is CNCNCc1c(C)ncnc1C(F)(F)F.
What is the InChIKey of N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine?
The InChIKey is RMRZVZQYZPNECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N4/c1-6-7(3-14-4-13-2)8(9(10,11)12)16-5-15-6/h5,13-14H,3-4H2,1-2H3.
What are the key properties of N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine?
N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine has a molecular weight of 234.22 g/mol, XLogP of 1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[[4-methyl-6-(trifluoromethyl)pyrimidin-5-yl]methyl]methanediamine is sourced from PubChem (CID 163935804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).