C25H32N2O3 — CID 163939922
2-(hydroxymethyl)-4-[1-hydroxy-2-[2-[4-(2-phenylethylamino)cyclohexa-2,4-dien-1-yl]ethylamino]ethyl]phenol (PubChem CID 163939922) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-[1-hydroxy-2-[2-[4-(2-phenylethylamino)cyclohexa-2,4-dien-1-yl]ethylamino]ethyl]phenol.
| Compound Name | 2-(hydroxymethyl)-4-[1-hydroxy-2-[2-[4-(2-phenylethylamino)cyclohexa-2,4-dien-1-yl]ethylamino]ethyl]phenol |
|---|---|
| PubChem CID | 163939922 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-(hydroxymethyl)-4-[1-hydroxy-2-[2-[4-(2-phenylethylamino)cyclohexa-2,4-dien-1-yl]ethylamino]ethyl]phenol |
| SMILES | OCc1cc(C(O)CNCCC2C=CC(NCCc3ccccc3)=CC2)ccc1O |
| InChI | InChI=1S/C25H32N2O3/c28-18-22-16-21(8-11-24(22)29)25(30)17-26-14-12-20-6-9-23(10-7-20)27-15-13-19-4-2-1-3-5-19/h1-6,8-11,16,20,25-30H,7,12-15,17-18H2 |
| InChIKey | RQCXSTIUATVBTO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|