C19H21F2N2O2S+ — CID 163940035
[(Z)-1-[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]-4-iminopent-2-en-2-yl]oxidanium (PubChem CID 163940035) has the molecular formula C19H21F2N2O2S+ and a molecular weight of 379.45 g/mol. Its IUPAC name is [(Z)-1-[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]-4-iminopent-2-en-2-yl]oxidanium.
| Compound Name | [(Z)-1-[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]-4-iminopent-2-en-2-yl]oxidanium |
|---|---|
| PubChem CID | 163940035 |
| Molecular Formula | C19H21F2N2O2S+ |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [(Z)-1-[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]-4-iminopent-2-en-2-yl]oxidanium |
| SMILES | [H]/N=C(C)/C=C(\[OH2+])COc1c(F)cc(-c2cccc(SC(C)C)n2)cc1F |
| InChI | InChI=1S/C19H20F2N2O2S/c1-11(2)26-18-6-4-5-17(23-18)13-8-15(20)19(16(21)9-13)25-10-14(24)7-12(3)22/h4-9,11,22,24H,10H2,1-3H3/p+1/b14-7-,22-12+ |
| InChIKey | RQEXHYPZMPUMON-PFIKJKKTSA-O |
| XLogP | 4.55 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|