C32H35ClN2O5U — CID 163941647
carbanide;phenyl 6-chloro-9-ethyl-1-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate;uranium(2+) (PubChem CID 163941647) has the molecular formula C32H35ClN2O5U and a molecular weight of 801.12 g/mol. Its IUPAC name is carbanide;phenyl 6-chloro-9-ethyl-1-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate;uranium(2+).
| Compound Name | carbanide;phenyl 6-chloro-9-ethyl-1-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate;uranium(2+) |
|---|---|
| PubChem CID | 163941647 |
| Molecular Formula | C32H35ClN2O5U |
| Molecular Weight | 801.12 g/mol |
| Exact Mass | 800.27 |
| IUPAC Name | carbanide;phenyl 6-chloro-9-ethyl-1-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate;uranium(2+) |
| SMILES | CCn1c2c(c3cc(Cl)ccc31)CCN(C(=O)Oc1cc[c-]cc1)C2c1ccc(OCCOCCOC)cc1.[CH3-].[U+2] |
| InChI | InChI=1S/C31H32ClN2O5.CH3.U/c1-3-33-28-14-11-23(32)21-27(28)26-15-16-34(31(35)39-25-7-5-4-6-8-25)29(30(26)33)22-9-12-24(13-10-22)38-20-19-37-18-17-36-2;;/h5-14,21,29H,3,15-20H2,1-2H3;1H3;/q2*-1;+2 |
| InChIKey | XGMPTXIEAGITJI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 62.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.12 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|