C26H22Cl2N2O3 — CID 171351739
(4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate (PubChem CID 171351739) has the molecular formula C26H22Cl2N2O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 171351739 |
| Molecular Formula | C26H22Cl2N2O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-(4-methoxyphenyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3c(c4cc(Cl)ccc4n3C)CCN2C(=O)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O3/c1-29-23-12-7-18(28)15-22(23)21-13-14-30(26(31)33-20-10-5-17(27)6-11-20)24(25(21)29)16-3-8-19(32-2)9-4-16/h3-12,15,24H,13-14H2,1-2H3 |
| InChIKey | QBVIWWHXRZKNKM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|