C21H30N2O2S — CID 163944032
13-hydroxy-12-(5,6,7,8-tetrahydro-2H-1,2,4-benzothiadiazin-3-yl)bicyclo[8.3.1]tetradec-12-en-11-one (PubChem CID 163944032) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is 13-hydroxy-12-(5,6,7,8-tetrahydro-2H-1,2,4-benzothiadiazin-3-yl)bicyclo[8.3.1]tetradec-12-en-11-one.
| Compound Name | 13-hydroxy-12-(5,6,7,8-tetrahydro-2H-1,2,4-benzothiadiazin-3-yl)bicyclo[8.3.1]tetradec-12-en-11-one |
|---|---|
| PubChem CID | 163944032 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 13-hydroxy-12-(5,6,7,8-tetrahydro-2H-1,2,4-benzothiadiazin-3-yl)bicyclo[8.3.1]tetradec-12-en-11-one |
| SMILES | O=C1C(C2=NC3=C(CCCC3)SN2)=C(O)C2CCCCCCCCC1C2 |
| InChI | InChI=1S/C21H30N2O2S/c24-19-14-9-5-3-1-2-4-6-10-15(13-14)20(25)18(19)21-22-16-11-7-8-12-17(16)26-23-21/h14-15,24H,1-13H2,(H,22,23) |
| InChIKey | RTNIFGWECVXPGS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|