C20H27NO2S — CID 163619345
9-(2,5,6,7,8,9-hexahydro-1,2-benzothiazepin-3-yl)bicyclo[5.3.1]undecane-8,10-dione (PubChem CID 163619345) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is 9-(2,5,6,7,8,9-hexahydro-1,2-benzothiazepin-3-yl)bicyclo[5.3.1]undecane-8,10-dione.
| Compound Name | 9-(2,5,6,7,8,9-hexahydro-1,2-benzothiazepin-3-yl)bicyclo[5.3.1]undecane-8,10-dione |
|---|---|
| PubChem CID | 163619345 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 9-(2,5,6,7,8,9-hexahydro-1,2-benzothiazepin-3-yl)bicyclo[5.3.1]undecane-8,10-dione |
| SMILES | O=C1C2CCCCCC(C2)C(=O)C1C1=CCC2=C(CCCC2)SN1 |
| InChI | InChI=1S/C20H27NO2S/c22-19-14-7-2-1-3-8-15(12-14)20(23)18(19)16-11-10-13-6-4-5-9-17(13)24-21-16/h11,14-15,18,21H,1-10,12H2 |
| InChIKey | HMTUZBXRJNENCG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|