C24H31N5O2S — CID 163944992
N-(1-amino-1-hydrazinyl-4-methylsulfanylbutan-2-yl)-2-cyclohexa-1,5-dien-1-yl-4-(pyridin-3-yloxymethyl)benzamide (PubChem CID 163944992) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-(1-amino-1-hydrazinyl-4-methylsulfanylbutan-2-yl)-2-cyclohexa-1,5-dien-1-yl-4-(pyridin-3-yloxymethyl)benzamide.
| Compound Name | N-(1-amino-1-hydrazinyl-4-methylsulfanylbutan-2-yl)-2-cyclohexa-1,5-dien-1-yl-4-(pyridin-3-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 163944992 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-(1-amino-1-hydrazinyl-4-methylsulfanylbutan-2-yl)-2-cyclohexa-1,5-dien-1-yl-4-(pyridin-3-yloxymethyl)benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(COc2cccnc2)cc1C1=CCCC=C1)C(N)NN |
| InChI | InChI=1S/C24H31N5O2S/c1-32-13-11-22(23(25)29-26)28-24(30)20-10-9-17(16-31-19-8-5-12-27-15-19)14-21(20)18-6-3-2-4-7-18/h3,5-10,12,14-15,22-23,29H,2,4,11,13,16,25-26H2,1H3,(H,28,30) |
| InChIKey | RUHWJJGDXJEOLC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|