C24H42N4O7 — CID 163945471
(2R,3R,4R,5S)-2-[methyl-[6-[4-(morpholin-4-ylmethyl)-2-nitroanilino]hexyl]amino]hexane-1,3,4,5-tetrol (PubChem CID 163945471) has the molecular formula C24H42N4O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[methyl-[6-[4-(morpholin-4-ylmethyl)-2-nitroanilino]hexyl]amino]hexane-1,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S)-2-[methyl-[6-[4-(morpholin-4-ylmethyl)-2-nitroanilino]hexyl]amino]hexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 163945471 |
| Molecular Formula | C24H42N4O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | (2R,3R,4R,5S)-2-[methyl-[6-[4-(morpholin-4-ylmethyl)-2-nitroanilino]hexyl]amino]hexane-1,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)N(C)CCCCCCNc1ccc(CN2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H42N4O7/c1-18(30)23(31)24(32)22(17-29)26(2)10-6-4-3-5-9-25-20-8-7-19(15-21(20)28(33)34)16-27-11-13-35-14-12-27/h7-8,15,18,22-25,29-32H,3-6,9-14,16-17H2,1-2H3/t18-,22+,23+,24+/m0/s1 |
| InChIKey | RURZFTGXLDADHP-LWZKNFMGSA-N |
| XLogP | 0.79 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|