C10H16N2 — CID 163946991
2-(2,3,4,5-tetrahydropyridin-6-yl)-1,2,3,4-tetrahydropyridine (PubChem CID 163946991) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-(2,3,4,5-tetrahydropyridin-6-yl)-1,2,3,4-tetrahydropyridine.
| Compound Name | 2-(2,3,4,5-tetrahydropyridin-6-yl)-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 163946991 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-(2,3,4,5-tetrahydropyridin-6-yl)-1,2,3,4-tetrahydropyridine |
| SMILES | C1=CNC(C2=NCCCC2)CC1 |
| InChI | InChI=1S/C10H16N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h3,7,9,11H,1-2,4-6,8H2 |
| InChIKey | RVZCGDGXKNBRGJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |