C22H28N8O2 — CID 163947297
1-(4a,5,8,8a-tetrahydroquinazolin-2-ylmethyl)-8-[(3R)-3-aminopiperidin-1-yl]-7-ethenyl-3-methylpurine-2,6-dione (PubChem CID 163947297) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-(4a,5,8,8a-tetrahydroquinazolin-2-ylmethyl)-8-[(3R)-3-aminopiperidin-1-yl]-7-ethenyl-3-methylpurine-2,6-dione.
| Compound Name | 1-(4a,5,8,8a-tetrahydroquinazolin-2-ylmethyl)-8-[(3R)-3-aminopiperidin-1-yl]-7-ethenyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 163947297 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-(4a,5,8,8a-tetrahydroquinazolin-2-ylmethyl)-8-[(3R)-3-aminopiperidin-1-yl]-7-ethenyl-3-methylpurine-2,6-dione |
| SMILES | C=Cn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(CC1=NC3CC=CCC3C=N1)c(=O)n2C |
| InChI | InChI=1S/C22H28N8O2/c1-3-29-18-19(26-21(29)28-10-6-8-15(23)12-28)27(2)22(32)30(20(18)31)13-17-24-11-14-7-4-5-9-16(14)25-17/h3-5,11,14-16H,1,6-10,12-13,23H2,2H3/t14?,15-,16?/m1/s1 |
| InChIKey | RWFZRWAABNQUBJ-HWOWSKLDSA-N |
| XLogP | 0.74 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|