C18H20N4O2 — CID 163947461
2-imidazo[1,2-a]pyridin-2-yl-N-(morpholin-4-yloxymethyl)aniline (PubChem CID 163947461) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-2-yl-N-(morpholin-4-yloxymethyl)aniline.
| Compound Name | 2-imidazo[1,2-a]pyridin-2-yl-N-(morpholin-4-yloxymethyl)aniline |
|---|---|
| PubChem CID | 163947461 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-2-yl-N-(morpholin-4-yloxymethyl)aniline |
| SMILES | c1ccc(-c2cn3ccccc3n2)c(NCON2CCOCC2)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-2-6-16(19-14-24-22-9-11-23-12-10-22)15(5-1)17-13-21-8-4-3-7-18(21)20-17/h1-8,13,19H,9-12,14H2 |
| InChIKey | RWJIJAYJTSFFJL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|