C19H14ClF3N2OS — CID 163948303
N-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-ethylsulfanylnaphthalene-2-carboxamide (PubChem CID 163948303) has the molecular formula C19H14ClF3N2OS and a molecular weight of 410.85 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-ethylsulfanylnaphthalene-2-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-ethylsulfanylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 163948303 |
| Molecular Formula | C19H14ClF3N2OS |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-ethylsulfanylnaphthalene-2-carboxamide |
| SMILES | CCSc1cc2ccccc2cc1C(=O)Nc1cc(C(F)(F)F)cnc1Cl |
| InChI | InChI=1S/C19H14ClF3N2OS/c1-2-27-16-8-12-6-4-3-5-11(12)7-14(16)18(26)25-15-9-13(19(21,22)23)10-24-17(15)20/h3-10H,2H2,1H3,(H,25,26) |
| InChIKey | RXBZEPDHRGMWCX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|