C26H36N4O — CID 163949508
3-[1-[2-(1,2-dimethyl-4-methylidene-7,8,9,9a-tetrahydro-6H-pyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-4-yl]-6-methyl-1,2-benzoxazole (PubChem CID 163949508) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is 3-[1-[2-(1,2-dimethyl-4-methylidene-7,8,9,9a-tetrahydro-6H-pyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-4-yl]-6-methyl-1,2-benzoxazole.
| Compound Name | 3-[1-[2-(1,2-dimethyl-4-methylidene-7,8,9,9a-tetrahydro-6H-pyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-4-yl]-6-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 163949508 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 3-[1-[2-(1,2-dimethyl-4-methylidene-7,8,9,9a-tetrahydro-6H-pyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-4-yl]-6-methyl-1,2-benzoxazole |
| SMILES | C=C1C(CCN2CCC(c3noc4cc(C)ccc34)CC2)=C(C)N(C)C2CCCCN12 |
| InChI | InChI=1S/C26H36N4O/c1-18-8-9-23-24(17-18)31-27-26(23)21-10-14-29(15-11-21)16-12-22-19(2)28(4)25-7-5-6-13-30(25)20(22)3/h8-9,17,21,25H,3,5-7,10-16H2,1-2,4H3 |
| InChIKey | RYBXCYPDPWSDFE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |