C20H21F7O3 — CID 163949684
2-[2,3-difluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane (PubChem CID 163949684) has the molecular formula C20H21F7O3 and a molecular weight of 442.37 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[2,3-difluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 163949684 |
| Molecular Formula | C20H21F7O3 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[2,3-difluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)phenyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
| SMILES | CC1CCC(C2COC(c3ccc(OC(F)(F)C(F)=C(F)F)c(F)c3F)OC2)CC1 |
| InChI | InChI=1S/C20H21F7O3/c1-10-2-4-11(5-3-10)12-8-28-19(29-9-12)13-6-7-14(16(22)15(13)21)30-20(26,27)17(23)18(24)25/h6-7,10-12,19H,2-5,8-9H2,1H3 |
| InChIKey | RYFRJPGDEIQWKJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |