C25H26N4O3 — CID 163953018
benzyl N-[3-[1-(3-oxopent-1-en-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate (PubChem CID 163953018) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is benzyl N-[3-[1-(3-oxopent-1-en-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate.
| Compound Name | benzyl N-[3-[1-(3-oxopent-1-en-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 163953018 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | benzyl N-[3-[1-(3-oxopent-1-en-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
| SMILES | C=C(C(=O)CC)N1CC=C(c2c[nH]c3ncc(NC(=O)OCc4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C25H26N4O3/c1-3-23(30)17(2)29-11-9-19(10-12-29)22-15-27-24-21(22)13-20(14-26-24)28-25(31)32-16-18-7-5-4-6-8-18/h4-9,13-15H,2-3,10-12,16H2,1H3,(H,26,27)(H,28,31) |
| InChIKey | SAYUXOQOEHLBCD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|