C21H20N4O3 — CID 134445682
benzyl N-[3-(1-prop-2-enoylazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate (PubChem CID 134445682) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is benzyl N-[3-(1-prop-2-enoylazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate.
| Compound Name | benzyl N-[3-(1-prop-2-enoylazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 134445682 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | benzyl N-[3-(1-prop-2-enoylazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
| SMILES | C=CC(=O)N1CC(c2c[nH]c3ncc(NC(=O)OCc4ccccc4)cc23)C1 |
| InChI | InChI=1S/C21H20N4O3/c1-2-19(26)25-11-15(12-25)18-10-23-20-17(18)8-16(9-22-20)24-21(27)28-13-14-6-4-3-5-7-14/h2-10,15H,1,11-13H2,(H,22,23)(H,24,27) |
| InChIKey | WTIPLASUTLBLLB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|