C23H28N4O5 — CID 174778758
benzyl N-[3-(3-hydroxyazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate;tert-butyl formate (PubChem CID 174778758) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is benzyl N-[3-(3-hydroxyazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate;tert-butyl formate.
| Compound Name | benzyl N-[3-(3-hydroxyazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate;tert-butyl formate |
|---|---|
| PubChem CID | 174778758 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | benzyl N-[3-(3-hydroxyazetidin-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=C(Nc1cnc2[nH]cc(C3(O)CNC3)c2c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N4O3.C5H10O2/c23-17(25-9-12-4-2-1-3-5-12)22-13-6-14-15(18(24)10-19-11-18)8-21-16(14)20-7-13;1-5(2,3)7-4-6/h1-8,19,24H,9-11H2,(H,20,21)(H,22,23);4H,1-3H3 |
| InChIKey | LLRWKTVNWDYHSS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|