C29H36FN3O3 — CID 163953276
methyl 2-[(1R,2S)-2-[(S)-(3-fluorophenyl)-isocyano-[1-(4-pyrrol-1-ylbutanoyl)piperidin-4-yl]methyl]cyclopentyl]acetate (PubChem CID 163953276) has the molecular formula C29H36FN3O3 and a molecular weight of 493.62 g/mol. Its IUPAC name is methyl 2-[(1R,2S)-2-[(S)-(3-fluorophenyl)-isocyano-[1-(4-pyrrol-1-ylbutanoyl)piperidin-4-yl]methyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2S)-2-[(S)-(3-fluorophenyl)-isocyano-[1-(4-pyrrol-1-ylbutanoyl)piperidin-4-yl]methyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 163953276 |
| Molecular Formula | C29H36FN3O3 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | methyl 2-[(1R,2S)-2-[(S)-(3-fluorophenyl)-isocyano-[1-(4-pyrrol-1-ylbutanoyl)piperidin-4-yl]methyl]cyclopentyl]acetate |
| SMILES | [C-]#[N+][C@@](c1cccc(F)c1)(C1CCN(C(=O)CCCn2cccc2)CC1)[C@H]1CCC[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C29H36FN3O3/c1-31-29(24-9-6-10-25(30)21-24,26-11-5-8-22(26)20-28(35)36-2)23-13-18-33(19-14-23)27(34)12-7-17-32-15-3-4-16-32/h3-4,6,9-10,15-16,21-23,26H,5,7-8,11-14,17-20H2,2H3/t22-,26+,29-/m1/s1 |
| InChIKey | SBEJCNHXYPPNMA-GNPWNAQMSA-N |
| XLogP | 5.44 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|