C12H17NS — CID 163953630
6-butan-2-yl-2-methyl-3a,7a-dihydro-1,3-benzothiazole (PubChem CID 163953630) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 6-butan-2-yl-2-methyl-3a,7a-dihydro-1,3-benzothiazole.
| Compound Name | 6-butan-2-yl-2-methyl-3a,7a-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 163953630 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-butan-2-yl-2-methyl-3a,7a-dihydro-1,3-benzothiazole |
| SMILES | CCC(C)C1=CC2SC(C)=NC2C=C1 |
| InChI | InChI=1S/C12H17NS/c1-4-8(2)10-5-6-11-12(7-10)14-9(3)13-11/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | SBMJPXVBETUCTO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |