C17H22N2O2 — CID 163954306
N-[(3R,4R)-4-but-2-ynoxy-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]methanimine (PubChem CID 163954306) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[(3R,4R)-4-but-2-ynoxy-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]methanimine.
| Compound Name | N-[(3R,4R)-4-but-2-ynoxy-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]methanimine |
|---|---|
| PubChem CID | 163954306 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[(3R,4R)-4-but-2-ynoxy-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]methanimine |
| SMILES | C=N[C@@H]1CN(Cc2ccc(OC)cc2)C[C@H]1OCC#CC |
| InChI | InChI=1S/C17H22N2O2/c1-4-5-10-21-17-13-19(12-16(17)18-2)11-14-6-8-15(20-3)9-7-14/h6-9,16-17H,2,10-13H2,1,3H3/t16-,17-/m1/s1 |
| InChIKey | SBZYLCLZFPQWRF-IAGOWNOFSA-N |
| XLogP | 1.99 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|