C16H23ClN2O — CID 178119779
(3S,5S)-1-[(4-methoxyphenyl)methyl]-5-prop-1-ynylpiperidin-3-amine;hydrochloride (PubChem CID 178119779) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is (3S,5S)-1-[(4-methoxyphenyl)methyl]-5-prop-1-ynylpiperidin-3-amine;hydrochloride.
| Compound Name | (3S,5S)-1-[(4-methoxyphenyl)methyl]-5-prop-1-ynylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 178119779 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3S,5S)-1-[(4-methoxyphenyl)methyl]-5-prop-1-ynylpiperidin-3-amine;hydrochloride |
| SMILES | CC#C[C@@H]1C[C@H](N)CN(Cc2ccc(OC)cc2)C1.Cl |
| InChI | InChI=1S/C16H22N2O.ClH/c1-3-4-14-9-15(17)12-18(11-14)10-13-5-7-16(19-2)8-6-13;/h5-8,14-15H,9-12,17H2,1-2H3;1H/t14-,15+;/m1./s1 |
| InChIKey | ZBCGHPMFEMNJDK-LIOBNPLQSA-N |
| XLogP | 2.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|