C27H23FN2O2 — CID 163955495
4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-5-fluoro-2-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 163955495) has the molecular formula C27H23FN2O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-5-fluoro-2-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-5-fluoro-2-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 163955495 |
| Molecular Formula | C27H23FN2O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-5-fluoro-2-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C#Cc1cc(-c2c(F)cnc3[nH]c(-c4ccc(C)cc4)cc23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C27H23FN2O2/c1-3-18-14-20(8-9-25(18)32-21-10-12-31-13-11-21)26-22-15-24(19-6-4-17(2)5-7-19)30-27(22)29-16-23(26)28/h1,4-9,14-16,21H,10-13H2,2H3,(H,29,30) |
| InChIKey | SCZGGIHGTOWGFF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|